What is the structural formula of 3-ethyl-2 ,5 dimethylheptane?
"hep" = 7 carbon structure and "ane"=single bonds CCCCCCC 3-ethyl is the 3rd carbon with a 2 carbons on it 1 2 3 4 5 6 7 CCCCCCC cc and 2,5 di methyl just means one carbon on each 2 and 5 1 2 3 4 5 6 7 CCCCCCC C | C CC
What is the structural diagram for: 4-ethyl-3,5-dimethyloctane?
CH3-CH2-CH(CH3)-CH(C2H5)-CH(CH3)-CH2-CH2...
What is the structure for 2-ethyl-4-methylheptane?
3,5-dimethyloctane
Does 3-ethyl-4,5-dimethyloctane exist?
Yes. It's: H---C---C---C---C---C---C---C---C---H ......................|......|......| ....................et.. me..me where et = ethyl group and me = methyl group and all the missing bonds are H's.
Which is correct? 3-ethyl-4-methyl hexane or 4-ethyl-3-methyl hexane.
In IUPAC system, alphabetical order is preferred and carbon containing more substituent will get lowest possible number.So first one will be correct. 3-Ethyl-4-methylhexane
What is the structural formula of 4-ethyl-2,2-dimethylhexane?
Here's how 4-ethyl-2,2-dimethylhexane should look……structurally
The structural formula of 5-(1-ethyl-1,3-dimethyl)nonane...
There's something missing from your "5-(1-ethyl-1,3-dimethyl)nonane". As it stands the name doesn't make sense: there should be something in the bracket after the (1-ethyl-1,3-dimethyl...) bit. 3-(1,1-dimethylethyl)-4-ethylheptane is OK. It's CH3-CH2-CH(X)-CH(C2H5)-CH2-CH2-CH3 Where 'X' is CH3-C(CH3)-CH3 joined to the main-chain by that middle carbon. However this compound is much more simply named as 3,4-diethyl-2,2-dimethylheptane.
Why is 3-ethyl-5,6-dimethyloctane wrong?
According to IUPAC nomenclature rules, for the non aromatic hydrocarbons, first you must look for the longest carbon chain, and that is a nonane. You can appreciate it if you write the nine carbon in line, and then place three methyl groups on that nonane chain in positions 3, 6 and 7 or in positions 3, 4 and 7 which is the same molecular structure, but one starting in one extreme and the other in the oposite extreme. Both describe exactly the same molecular structure. Now your homework is to look in the other rules to see which is the right name 3,6,7 three methyl nonane or 3,4,7 three methyl nonane.