What is the name of the following compound CH2=CHCH2CH(C6H5)(CH2)4CH3?
Name is 4-phenyl-1-nonene because the longest chain of carbon atoms contains nine carbon atoms with one carbon-carbon double bond beginning at the first carbon. The phenyl group is attached at the 4th carbon atom. A phenyl group is the functional group C6H5. It is the portion of an organic molecule that is derived from a benzene molecule, C6H6, by removal of a hydrogen atom.
What is the name of the following compound: CO?
Carbon Monoxide.
What is the IUPAC name for the following compounds: Ch3-ch3-ch3-c-ch2-ch-ch3-ch3?
Firstly, I think that you have written it out wrong, carbon can only form 4 bonds and on some of those carbons there are 5 bonds or even only 3; where the Carbon should be labelled with a ‘+’ sign as it is positively charged due to having a single unpaired electron. CH3 is not formed in the middle of any carbon chain, only the end of a chain where there is a single bond e.g. ethane H3C-CH3. It should read:H2C=CH-CH2-CH2-CH2-CH2-CH2-CH=CH2
What is the IUPAC name of the following compounds: CH3-CH=CH-CH(OH)-CH2-CH3?
Hex-2-ene-4-ol
Name the following compounds? Pl3, H2SO4, As2O5, CCl4, N2O4, with the numbers being under?
Phosphorus iodide, sulfurice acid, arsenic oxide, Carbon tetrachloride, dinitrogen tetraoxide
What is the name of the following compounds? HNO2, FeO, Fe2O3,?
HNO2... nitrous acid FeO... iron (ll) oxide Fe203.. iron (lll) oxide or ferric oxide Well at least thats what i think it is :P Hope it helped.
Name the following compounds: MgS, NH4CL and K2O?
Magnesium Sulfide (MgS) Nitrate Chloride (NH4Cl) Potassium Oxide (K2O)