What is the distinguish test between alcohol and phenol?
Phenol is weakly acidic hence turns blue litmus red. It gives positive dye test, whereas alcohols do not show dye test.Phenol gives violet coloured ferric phenoxide complex with aqueous neutral ferric chloride whereas alcohols do not.
What chemical tests could you use to distinguish between 2-pentanone and 3-pentanone?
Iodoform test---- 2-pentanone being a methy ketone when treated with NAOI(I2+NAOH) gives yellow precipitate of iodoform but 3-pentanone does not...... CH3CH2CH2COCH3 + 3NAOI ----------> CH3CH2CH2COONA(sodium butyrate ) + CHI3(iodoform) + 2NAOH CH3CH2COCH2CH3 + NAOI ---------> no reaction another test is sodium bisulphite test------ 2-pentanone being a methyl ketone when treated with saturated solution of sodium bisulfite gives a white precipitate of 2-pentanone sodium bisulphite addition compound whereas 3-pentanone does not..... CH3CH2CH2COCH3 + NaHSO3 ---------> CH3CH2CH2-C(OH)(SO3Na)-CH3 (2-pentanone sodium bisulfite addition compound) OH and SO3Na are present on the same carbon... CH3CH2COCH2CH3 + NaHSO3 --------> no reaction
What are the two chemical tests that can distinguish between butane and butene?
1) Bromination: add a drop or two of dilute bromine (Br2) to the sample, if the brown color disappears, it is an alkene, and... 2) Baeyer's Test: add a drop or two of potassium permanganate (KMnO4) to the sample, if the purple color disappears, it is an alkene.
What is the test to distinguish between ethanol and ethanamine?
Carbylamine TestWhen an amine is treated with haloform in presence of a base, it produces respective isocyanide, which gives a foul smell and hence can be used for distinction of between ethanamine and ethanol.Test with carboxylic acidIf ethanol is treated with carboxylic acid then it produces ester which is a fruity smelling compound.The easiest way to distinguish them would be to check their [math]pK_a[/math] since the amine would have a greater [math]pK_a [/math]value than alcohol.
How could you distinguish solution from colloid?
A colloid is a type of mechanical mixture where one substance is dispersed evenly throughout another. Because of this dispersal, some colloids have the appearance of solutions. Milk is an example of a colloid. a solution is a homogeneous mixture composed of two or more substances. In such a mixture, a solute is dissolved in another substance, known as a solvent. A common example is a solid, such as salt or sugar, dissolved in water, a liquid.
Test that would distinguish between lactic and acrylic acid?
The main difference between lactic acid and acrylic acid is that acrylic acid can be a product of dehydration from lactic acid (or lactic acid can be a product of hydration from acrylic acid), so acrylic acid has a double bond and lactic acid does not. So you can probably use bromine test. A positive bromine test would indicate the acid is acrylic acid, and a negative would indicate it is lactic acid.
How will you distinguish between Propan-1-ol and 2-methyl propan-2-ol?
Let’s look at the structure of Propan-1-ol and 2-methyl propan-2-ol,This is Propan-1-ol or generally known as Propanol.The carbon atom to which the alcoholic functional group is attached is a [math]1^o [/math]Carbon atom or a Primary Carbon atom, i.e it is linked to a single carbon atom only.While,this is 2-methyl propan-2-ol.The carbon atom to which the alcoholic functional group is attached is a [math]3^o[/math][math] [/math]Carbon atom or a Tertiary Carbon atom, i.e it is linked to three carbon atoms.Now this is how we can distinguish them on their structure, but if it was a CHEMICAL DISTINGUISHING TEST you’re seeking, then we can actually use Luka’s Test to distinguish between them.Now coming to what is Luca’s Test,Luca’s test includes a reaction between an alcohol with a Halogen hydride and it’s Zinc salt.Now the reason we can use this for our benefit is that,[math]1^o [/math]Carbon atoms or Primary carbon atoms undergo the reaction very fast and white fumes of Haloalkanes appear inside the flask or test tube.[math]2^o [/math]Carbon atoms or Secondary carbon atoms undergo the reaction at a slow rate and the fumes appear after a brief interval of time.While [math]3^o [/math]Carbon atom or a Tertiary Carbon atom won’t undergo the reaction until and unless the reaction mixture is heated.So, Propan-1-ol and 2-methyl propan-2-ol can be distinguished using Luca’s test as Propan-1-ol would give white fumes very easily while 2-methyl propan-2-ol won’t form any fumes until the reaction mixture is heated.
How to distinguish between alcohol and ketone with simple laboratory tests?
1. Add 2,4-Dinitrophenylhydrazine (2,4-DNPH) to a sample of both and heat it. A bright orange precipitate will be seen in the ketone but not the alcohol. 2. Add an oxidizing agent, e.g. Jones reagent (Chromium trioxide (CrO3) in sulfuric acid) to a sample of both an heat it. The solution will turn from orange (Cr (VI))to green (Cr (III))in the test tube containing the alcohol (due to oxidation of the alcohol) but not the ketone (they cannot be oxidized).
How can lie detectors distinguish between lying and anxiety?
They can't. Lie detectors are not actually lie detectors--they're stress detectors. If you have anxiety, the detector will show it. If you don't have anxiety and can lie calmly, the lie detector will show you as being "truthful."They try to control for anxiety by asking calibration questions the examiner already knows the answer to, such as "is today Tuesday?" and "is your name Fred?" Those supposedly set a baseline, with thei idea being that lies add more stress on top of that. Does it work? No. In fact, it gives you a way to beat lie detectors. Put a rock in your shoe, Step down on it during the calibration questions. That causes you pain and increases your anxiety. That sets a high baseline. When you lie, don't step down on the rock. Your body relaxes because you aren't in pain, and the lie detector doesn't register the lie.Lie detectors are often regarded as pseudoscience:The Pseudoscience Of Lie DetectorsPolygraphThe Skeptic Encyclopedia of Pseudoscience